For research use only. Not for therapeutic Use.
Malaoxon is an organophosphorus compound and a potent metabolite of the insecticide malathion, used in toxicological and environmental research. Known for its cholinesterase-inhibiting properties, it is essential for studying the toxic effects, environmental persistence, and degradation pathways of organophosphates. This compound aids in understanding the mechanisms of pesticide toxicity and developing safety regulations. Researchers rely on Malaoxon for precise and reliable results in advanced toxicology, environmental monitoring, and public health studies, contributing significantly to innovations in pesticide safety and environmental protection.
| Catalog Number | R009143 |
| CAS Number | 1634-78-2 |
| Synonyms | 2-[(Dimethoxyphosphinyl)thio]butanedioic Acid 1,4-Diethyl Ester; Diethyl?[(Dimethoxyphosphino)thio]butanedioate; Liromat; O,O-Dimethyl S-1,2-Bis(ethoxyca rbonyl)ethyl Phosphorothioate; Oxycarbophos; |
| Molecular Formula | C10H19O7PS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | diethyl 2-dimethoxyphosphorylsulfanylbutanedioate |
| InChI | InChI=1S/C10H19O7PS/c1-5-16-9(11)7-8(10(12)17-6-2)19-18(13,14-3)15-4/h8H,5-7H2,1-4H3 |
| InChIKey | WSORODGWGUUOBO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C(=O)OCC)SP(=O)(OC)OC |
