For research use only. Not for therapeutic Use.
Malathion α-Monoacid-d5(Cat No.:R053202) is a high-purity, deuterium-labeled compound essential for advanced biochemical and environmental research. Featuring five deuterium atoms, this isotopically labeled version of Malathion α-Monoacid is crucial for studies on pesticide metabolism, environmental fate, and toxicology. Malathion α-Monoacid-d5 is a valuable tool for scientific investigations, aiding in the development of safer pesticides and enhancing the understanding of metabolic and environmental processes.
CAS Number | 1794980-03-2 |
Synonyms | 2-[(Dimethoxyphosphinothioyl)thio]butanedioic Acid 4-Ethyl Ester; Malathion α-Monocarboxylic Acid; O,O-Dimethyl S-(1-carboxy-2-carbethoxy)ethyl Phosphorodithioate; |
Molecular Formula | C8H15O6PS2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-dimethoxyphosphinothioylsulfanyl-4-oxo-4-(1,1,2,2,2-pentadeuterioethoxy)butanoic acid |
InChI | InChI=1S/C8H15O6PS2/c1-4-14-7(9)5-6(8(10)11)17-15(16,12-2)13-3/h6H,4-5H2,1-3H3,(H,10,11)/i1D3,4D2 |
InChIKey | AJSJFDUIZFXAQY-SGEUAGPISA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)CC(C(=O)O)SP(=S)(OC)OC |