For research use only. Not for therapeutic Use.
Maleimide-NOTA(CAT: I040843) is a versatile bifunctional chelator designed for site-specific conjugation and radiolabeling applications. Featuring a maleimide group, it enables selective coupling with thiol-containing biomolecules, such as antibodies and peptides, for targeted radiopharmaceutical development. The NOTA (1,4,7-triazacyclononane-1,4,7-triacetic acid) moiety ensures strong and stable coordination with radiometals like gallium-68, enhancing imaging precision in positron emission tomography (PET). Ideal for bioconjugation and theranostic research, Maleimide-NOTA facilitates the development of highly specific and stable radiotracers, advancing cancer diagnostics and targeted radionuclide therapy.
| CAS Number | 1295584-83-6 |
| Synonyms | 2-[4-(carboxymethyl)-7-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid |
| Molecular Formula | C18H27N5O7 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-(carboxymethyl)-7-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid |
| InChI | InChI=1S/C18H27N5O7/c24-14(19-3-4-23-15(25)1-2-16(23)26)11-20-5-7-21(12-17(27)28)9-10-22(8-6-20)13-18(29)30/h1-2H,3-13H2,(H,19,24)(H,27,28)(H,29,30) |
| InChIKey | JZFBXLDURQNNQU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(CCN1CC(=O)NCCN2C(=O)C=CC2=O)CC(=O)O)CC(=O)O |
