Maleimidoacetic acid N-hydroxysuccinimide ester is a crosslinking reagent that contains NHS ester- and maleimide-reactive groups at the opposite ends of a 4.4 Å spacer arm. This configuration allows for sequential, two-stage conjugation with amine and sulfhydryl functional groups in the preparation of protein-hapten or protein-protein conjugates.
| Catalog Number | R000172 |
| CAS Number | 55750-61-3 |
| Synonyms | 1-[2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl]-1H-pyrrole-2,5-dione; N-(α-Maleimidoacetoxy)succimide; |
| Molecular Formula | C10H8N2O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(2,5-dioxopyrrol-1-yl)acetate |
| InChI | InChI=1S/C10H8N2O6/c13-6-1-2-7(14)11(6)5-10(17)18-12-8(15)3-4-9(12)16/h1-2H,3-5H2 |
| InChIKey | TYKASZBHFXBROF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CN2C(=O)C=CC2=O |
