For research use only. Not for therapeutic Use.
Malioxamycin(CAT: R067595) is a rare and complex natural product isolated from marine-derived microorganisms, recognized for its potent antibacterial and antifungal properties. This compound belongs to the polyketide class and has shown significant activity against a range of pathogenic bacteria and fungi, making it a promising candidate for developing novel antimicrobial agents. The unique structure of Malioxamycin, coupled with its potent bioactivity, makes it a valuable tool in drug discovery and development, particularly in the search for new treatments for resistant infections. Researchers focusing on natural products and antimicrobial resistance will find Malioxamycin to be an essential compound for advancing their studies in combating infectious diseases.
| Catalog Number | R067595 |
| CAS Number | 73020-27-6 |
| Synonyms | [[[(2S)-2R-amino-3-methyl-1-oxobutyl]amino]oxy]-butanedioic acid |
| Molecular Formula | C9H16N2O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]oxybutanedioic acid |
| InChI | InChI=1S/C9H16N2O6/c1-4(2)7(10)8(14)11-17-5(9(15)16)3-6(12)13/h4-5,7H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/t5-,7+/m1/s1 |
| InChIKey | KXQRAPMNPUXYGT-VDTYLAMSSA-N |
| SMILES | CC(C)C(C(=O)NOC(CC(=O)O)C(=O)O)N |
