Malonic Acid-1,2,3-13C3（Cat No.:R044521） is a carbon-13 isotopically labeled version of malonic acid, extensively used in biochemical and pharmaceutical research. It features three carbon-13 isotopes, enhancing its utility in metabolic studies, tracing synthetic pathways, and studying enzyme mechanisms. This compound is particularly valuable in mass spectrometry, offering precise and reliable identification and quantification of metabolites in complex biological systems. Its high purity and stable isotopic enrichment make it an essential tool for researchers focused on cellular metabolism, drug development, and diagnostic applications.
| Catalog Number | R044521 |
| CAS Number | 102342-85-8 |
| Synonyms | Propanedioic Acid-1,2,3-13C3; 1,3-Propanedioic Acid-1,2,3-13C3; Carboxyacetic Acid-1,2,3-13C3; Dicarboxymethane-1,2,3-13C3; Methanedicarboxylic Acid-1,2,3-13C3; NSC 8124-2-1,2,3-13C3; [1,2,3-13C3]-Malonic acid |
| Molecular Formula | C3H4O4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (1,2,3-13C3)propanedioic acid |
| InChI | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1+1,2+1,3+1 |
| InChIKey | OFOBLEOULBTSOW-VMIGTVKRSA-N |
| SMILES | [13CH2]([13C](=O)O)[13C](=O)O |
