For research use only. Not for therapeutic Use.
Malonic Acid-d4 (Cat No.:C000864) is a deuterated form of malonic acid, a dicarboxylic acid used in organic synthesis and pharmaceutical research. The “-d4” in the compound’s name indicates that four hydrogen atoms in malonic acid have been replaced with deuterium, a stable isotope of hydrogen. Deuterated compounds are commonly used as internal standards in analytical chemistry, especially in NMR spectroscopy and mass spectrometry. Malonic Acid-d4 serves as a reference standard for quantification and isotopic labeling studies, providing valuable insights into reaction mechanisms, kinetic studies, and metabolic pathways in various research fields.
| Catalog Number | C000864 |
| CAS Number | 813-56-9 |
| Synonyms | Propanedioic-2,2-d2 Acid-1,3-d2; Malonic-d2 Acid-d2; Propanedioic-d2 Acid-d2; Tetradeuteriomalonic Acid; Propanedioic Acid-d4; 1,3-Propanedioic Acid-d4; Carboxyacetic Acid-d4; Dicarboxymethane-d4; Methanedicarboxylic Acid-d4; NSC 8124-d4 |
| Molecular Formula | C₃D₄O₄ |
| Purity | ≥95% |
| Solubility | DMSO, Metahnol |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Hygroscopic |
| IUPAC Name | dideuterio 2,2-dideuteriopropanedioate |
| InChI | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| InChIKey | OFOBLEOULBTSOW-BGOGGDMHSA-N |
| SMILES | C(C(=O)O)C(=O)O |
| Reference | ‘Weiner, N., ”Malonic Acid”, Org. Synth.; Coll. Vol. 2: 376’ |
