For research use only. Not for therapeutic Use.
Malonomicin (Cat.No:R074775) is a naturally occurring macrolide antibiotic isolated from the bacterium Streptomyces malonaldehyde. It exhibits broad-spectrum antimicrobial activity against various bacteria, including Gram-positive and some Gram-negative species. Malonomicin’s unique structure makes it valuable in pharmaceutical research for potential therapeutic applications in bacterial infections.
| Catalog Number | R074775 |
| CAS Number | 38249-71-7 |
| Molecular Formula | C13H18N4O9 |
| Purity | ≥95% |
| Target | Antibiotic |
| IUPAC Name | 2-[(2-amino-3-hydroxypropanoyl)amino]-2-[2-[2-(aminomethyl)-3-hydroxy-5-oxo-1,2-dihydropyrrol-4-yl]-2-oxoethyl]propanedioic acid |
| InChI | InChI=1S/C13H18N4O9/c14-2-5-8(20)7(10(22)16-5)6(19)1-13(11(23)24,12(25)26)17-9(21)4(15)3-18/h4-5,18,20H,1-3,14-15H2,(H,16,22)(H,17,21)(H,23,24)(H,25,26) |
| InChIKey | IPQOAJQXCZEYLK-UHFFFAOYSA-N |
| SMILES | C(C1C(=C(C(=O)N1)C(=O)CC(C(=O)O)(C(=O)O)NC(=O)C(CO)N)O)N |
