For research use only. Not for therapeutic Use.
Maltose (Cat No.:I019920) is a disaccharide made up of two glucose units joined together by an α-1,4-glycosidic bond. It is commonly found in grains, such as barley and malted barley, and serves as a source of energy during germination. Maltose has a mildly sweet taste and is less sweet than sucrose. It is widely used in the food and beverage industry as a sweetener, a fermentation substrate for brewing, and as a component in various food products such as candies, baked goods, and infant formulas.
| Catalog Number | I019920 |
| CAS Number | 69-79-4 |
| Molecular Formula | C₁₂H₂₂O₁₁ |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | GUBGYTABKSRVRQ-QUYVBRFLSA-N |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
