For research use only. Not for therapeutic Use.
MAM2201 (Item No. <span class=/itemid/>9001219</span>) is a synthetic cannabinoid (CB) that is closely related, structurally, to AM2201 (Item No. <span class=/itemid/>10707</span>), a compound which displays high affinities for both CB receptors. MAM2201 N-<wbr></wbr>(3-<wbr></wbr>fluoropentyl) isomer differs from MAM2201 by having fluorine at the 3 position rather than the 5 position of the alkyl chain. The physiological and toxicological properties of this compound have not been evaluated. This product is intended for forensic and research applications.
| Catalog Number | R039833 |
| CAS Number | 1797983-61-9 |
| Synonyms | (1-(3-Fluoropentyl)-1H-indol-3-yl)(4-methylnaphthalen-1-yl)methanone; |
| Molecular Formula | C25H24FNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [1-(3-fluoropentyl)indol-3-yl]-(4-methylnaphthalen-1-yl)methanone |
| InChI | InChI=1S/C25H24FNO/c1-3-18(26)14-15-27-16-23(21-10-6-7-11-24(21)27)25(28)22-13-12-17(2)19-8-4-5-9-20(19)22/h4-13,16,18H,3,14-15H2,1-2H3 |
| InChIKey | KEFSMRMUICTKBX-UHFFFAOYSA-N |
| SMILES | CCC(CCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)C)F |
