For research use only. Not for therapeutic Use.
MAPK-IN-1（Cat No.:I043561）is a small-molecule inhibitor that targets the Mitogen-Activated Protein Kinase (MAPK) signaling pathway, a key regulator of cell growth, differentiation, and survival. By inhibiting specific kinases in the MAPK pathway, MAPK-IN-1 disrupts the signaling responsible for tumorigenesis, making it a potential therapeutic candidate for cancer treatment. It particularly shows promise in cancers driven by aberrant MAPK activation, such as melanoma and non-small cell lung cancer. MAPK-IN-1 offers an opportunity to block cancer cell proliferation and improve treatment outcomes in MAPK-driven malignancies.
| CAS Number | 2470587-69-8 |
| Synonyms | (1R)-1,6,6-trimethyl-1,2,8,9-tetrahydronaphtho[1,2-g][1]benzofuran-7,10,11-trione |
| Molecular Formula | C19H18O4 |
| Purity | ≥95% |
| IUPAC Name | (1R)-1,6,6-trimethyl-1,2,8,9-tetrahydronaphtho[1,2-g][1]benzofuran-7,10,11-trione |
| InChI | InChI=1S/C19H18O4/c1-9-8-23-18-11-4-6-12-10(5-7-13(20)19(12,2)3)15(11)17(22)16(21)14(9)18/h4,6,9H,5,7-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | ABVRZQXICIZPLM-VIFPVBQESA-N |
| SMILES | C[C@H]1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCC(=O)C4(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
