For research use only. Not for therapeutic Use.
Maribavir (Cat No.: I002293) is a potent antiviral drug that belongs to the class of benzimidazole ribosides. It specifically targets and inhibits the UL97 protein kinase, which is essential for the replication of cytomegalovirus (CMV). Maribavir acts by disrupting viral DNA synthesis and preventing the phosphorylation of viral proteins necessary for CMV replication. As a result, it exhibits potent antiviral activity against CMV strains, including those that are resistant to other antiviral agents. Maribavir has been investigated for the treatment and prevention of CMV infections in immunocompromised patients, such as transplant recipients, where CMV reactivation can lead to serious complications.
| Catalog Number | I002293 |
| CAS Number | 176161-24-3 |
| Synonyms | Maribavir; 1263W-94; BW-1263W-94; GW-1263; GW-257406X; SHP-620; VP-41263; BW-1263W94; 1263W94; BW1263W-94; GW1263; GW257406X; SHP620; VP41263; BW1263W94; (2S,3S,4R,5S)-2-((E)-5,6-dichloro-2-(isopropylimino)-2,3-dihydro-1H-benzo[d]imidazol-1-yl)-5-(hy |
| Molecular Formula | C15H19Cl2N3O4 |
| Purity | 98% |
| Target | CMV |
| Target Protein | P16788 |
| Solubility | DMSO: ≥ 51 mg/mL |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| Overview of Clinical Research | Originator: GlaxoSmithKline<br /> |
| IUPAC Name | (2S,3S,4R,5S)-2-[5,6-dichloro-2-(propan-2-ylamino)benzimidazol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChI | InChI=1S/C15H19Cl2N3O4/c1-6(2)18-15-19-9-3-7(16)8(17)4-10(9)20(15)14-13(23)12(22)11(5-21)24-14/h3-4,6,11-14,21-23H,5H2,1-2H3,(H,18,19)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | KJFBVJALEQWJBS-XUXIUFHCSA-N |
| SMILES | CC(C)NC1=NC2=CC(=C(C=C2N1[C@@H]3[C@H]([C@H]([C@@H](O3)CO)O)O)Cl)Cl |
| Reference | <br /> |
