For research use only. Not for therapeutic Use.
Martynoside (Cat No.: R007196) is a phenylpropanoid glycoside extracted from various medicinal plants, known for its potent anti-inflammatory, antioxidant, and neuroprotective properties. Widely used in pharmaceutical and biochemical research, Martynoside plays a crucial role in studying neurodegenerative diseases, inflammatory disorders, and oxidative stress-related conditions. Its ability to scavenge free radicals and inhibit inflammatory pathways makes it a valuable compound for developing new therapeutic strategies. Martynoside’s natural origin and multifaceted bioactivity offer promising potential for advancing health and wellness research.
CAS Number | 67884-12-2 |
Molecular Formula | C31H40O15 |
Purity | ≥95% |
Target | Plants |
Storage | -20°C |
IUPAC Name | [(2R,3R,4R,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-2-(hydroxymethyl)-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
InChI | InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-20(40-2)19(34)12-17)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)21(13-16)41-3/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6+/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1 |
InChIKey | WLWAYPFRKDSFCL-CNMJWYMJSA-N |
SMILES | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)OC)CO)OCCC4=CC(=C(C=C4)OC)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |