For research use only. Not for therapeutic Use.
MASM7（Cat No.:I043229）is a selective, small-molecule inhibitor designed to target specific protein kinases involved in cellular signaling pathways. It is known for its potential in modulating key biological processes like cell growth, survival, and metabolism. By inhibiting these pathways, MASM7 may offer therapeutic applications in various disease areas, including cancer and autoimmune conditions. Its precise mechanism of action makes it a promising candidate for developing targeted therapies, potentially leading to more effective and less toxic treatments compared to conventional approaches. Ongoing research is exploring its broader clinical applications.
| CAS Number | 920868-45-7 |
| Synonyms | 2-[2-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| Molecular Formula | C22H23N5O2S2 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| InChI | InChI=1S/C22H23N5O2S2/c1-12(20(29)24-21-17(18(23)28)15-8-5-9-16(15)31-21)30-22-26-25-19(13-10-11-13)27(22)14-6-3-2-4-7-14/h2-4,6-7,12-13H,5,8-11H2,1H3,(H2,23,28)(H,24,29) |
| InChIKey | MTAWXPCGCQTSOJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C2=C(S1)CCC2)C(=O)N)SC3=NN=C(N3C4=CC=CC=C4)C5CC5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
