For research use only. Not for therapeutic Use.
Masofaniten（Cat No.:I042657）is a small molecule compound that has shown potential in preclinical research, particularly in the fields of oncology and neurodegenerative diseases. It acts as a selective modulator of specific enzymes or receptors involved in disease pathways, making it a candidate for targeted therapy. In cancer research, Masofaniten is investigated for its ability to inhibit tumor growth and metastasis by disrupting key molecular signaling pathways. Additionally, it is being explored for its neuroprotective effects in conditions like Alzheimer’s disease, aiming to improve cognition and slow disease progression.
| CAS Number | 2416716-62-4 |
| Synonyms | N-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]methanesulfonamide |
| Molecular Formula | C24H24Cl2N4O4S |
| Purity | ≥95% |
| IUPAC Name | N-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]methanesulfonamide |
| InChI | InChI=1S/C24H24Cl2N4O4S/c1-24(2,18-12-16(14-27)22(21(26)13-18)33-11-9-25)17-4-6-20(7-5-17)34-15-19-8-10-28-23(29-19)30-35(3,31)32/h4-8,10,12-13H,9,11,15H2,1-3H3,(H,28,29,30) |
| InChIKey | GVCZSODXLFBYSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OCC2=NC(=NC=C2)NS(=O)(=O)C)C3=CC(=C(C(=C3)Cl)OCCCl)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
