For research use only. Not for therapeutic Use.
Masoprocol（Cat No.:I043484）is a synthetic antioxidant and anti-inflammatory agent that primarily acts by inhibiting lipoxygenase, an enzyme involved in the metabolism of arachidonic acid. It has been studied for its potential therapeutic effects in treating various inflammatory conditions, including skin disorders like actinic keratosis and basal cell carcinoma. By reducing the production of pro-inflammatory leukotrienes, Masoprocol helps to alleviate inflammation and oxidative stress. It has also shown some promise in cancer treatment by modulating tumor cell growth and enhancing the efficacy of other anticancer therapies, particularly in the skin cancer context.
| CAS Number | 27686-84-6 |
| Synonyms | 4-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| Molecular Formula | C18H22O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| InChI | InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ |
| InChIKey | HCZKYJDFEPMADG-TXEJJXNPSA-N |
| SMILES | C[C@H](CC1=CC(=C(C=C1)O)O)[C@@H](C)CC2=CC(=C(C=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
