For research use only. Not for therapeutic Use.
MAT2A inhibitor 1 is a methionine adenosyltransferase 2A (MATA2) inhibitor with an IC50 less than l00 nM[1].
MAT2A inhibitor 1 (Compound 196) is a safe and effective compound that prevents and manages cancers while reducing or avoiding the toxicities and/or side effects associated with the conventional therapies. The cancers include those that are refractory to standard treatments, such as surgery, radiation therapy, chemotherapy and hormonal therapy[1].
| Catalog Number | I020087 |
| CAS Number | 2201057-10-3 |
| Synonyms | 6-(2-methyl-1,3-benzothiazol-6-yl)-2,3-diphenyl-5-(pyridin-2-ylamino)-4H-pyrazolo[1,5-a]pyrimidin-7-one |
| Molecular Formula | C31H22N6OS |
| Purity | ≥95% |
| InChI | InChI=1S/C31H22N6OS/c1-19-33-23-16-15-22(18-24(23)39-19)27-29(34-25-14-8-9-17-32-25)35-30-26(20-10-4-2-5-11-20)28(36-37(30)31(27)38)21-12-6-3-7-13-21/h2-18,35H,1H3,(H,32,34) |
| InChIKey | ZTNQNZDNHUAVEI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C=C2)C3=C(NC4=C(C(=NN4C3=O)C5=CC=CC=C5)C6=CC=CC=C6)NC7=CC=CC=N7 |
| Reference | [1]. Zenon D, et al. Inhibitors of cellular metabolic processes. 08 March 2018. WO2018045071A1. |
