For research use only. Not for therapeutic Use.
Matairesinoside(Cat No.:R066384), is a natural compound extracted from the bark of Picea abies (Norway spruce) tree. It belongs to the class of lignan glycosides and exhibits antioxidant, anti-inflammatory, and potential anticancer properties. Matairesinoside has been traditionally used for its anti-inflammatory and diuretic effects in traditional medicine. Its complex chemical structure includes a lignan backbone with attached sugar molecules. While considered safe for consumption, further research is needed to explore its full potential, benefits, and possible side effects. Matairesinoside presents a promising natural compound for future investigations in healthcare and medicine.
CAS Number | 23202-85-9 |
Molecular Formula | C26H32O11 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-[[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]oxolan-2-one |
InChI | InChI=1S/C26H32O11/c1-33-19-9-13(3-5-17(19)28)7-15-12-35-25(32)16(15)8-14-4-6-18(20(10-14)34-2)36-26-24(31)23(30)22(29)21(11-27)37-26/h3-6,9-10,15-16,21-24,26-31H,7-8,11-12H2,1-2H3/t15-,16+,21+,22+,23-,24+,26+/m0/s1 |
InChIKey | AAGCATAPYOEULE-LHHMAMHXSA-N |
SMILES | COC1=C(C=CC(=C1)CC2COC(=O)C2CC3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)O |