For research use only. Not for therapeutic Use.
Matricin is a natural compound found in chamomile flowers (Matricaria chamomilla). Upon heating, matricin converts into chamazulene, a blue-colored compound responsible for chamomile’s characteristic hue. Matricin exhibits anti-inflammatory and antioxidant properties, contributing to chamomile’s traditional use in herbal medicine for skin conditions and gastrointestinal discomfort. Its natural origin and medicinal properties make it a valuable botanical ingredient.
| Catalog Number | R072609 |
| CAS Number | 29041-35-8 |
| Molecular Formula | C17H22O5 |
| Purity | ≥95% |
| IUPAC Name | [(3S,3aR,4S,9R,9aS,9bS)-9-hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
| InChI | InChI=1S/C17H22O5/c1-8-7-12(21-10(3)18)13-9(2)16(19)22-15(13)14-11(8)5-6-17(14,4)20/h5-6,9,12-15,20H,7H2,1-4H3/t9-,12-,13+,14-,15-,17+/m0/s1 |
| InChIKey | SYTRJRUSWMMZLV-VQGWEXQJSA-N |
| SMILES | CC1C2C(CC(=C3C=CC(C3C2OC1=O)(C)O)C)OC(=O)C |
