For research use only. Not for therapeutic Use.
Matrine (Cat No.:I003881) is a natural alkaloid compound derived from the root of the traditional Chinese herb Sophora flavescens. It has been used in traditional medicine for centuries due to its various pharmacological properties. Matrine exhibits anti-inflammatory, anticancer, antiviral, and immunomodulatory activities. It has been shown to inhibit the growth of cancer cells by inducing cell cycle arrest and apoptosis. Matrine also possesses anti-inflammatory effects by suppressing the production of pro-inflammatory cytokines and inhibiting the activation of inflammatory signaling pathways. Furthermore, it has demonstrated antiviral activity against several viruses, including hepatitis B and C viruses.
| Catalog Number | I003881 |
| CAS Number | 519-02-8 |
| Synonyms | (41S,7aS,13aR,13bR)-dodecahydro-1H-dipyrido[2,1-f:3/’,2/’,1/’-ij][1,6]naphthyridin-10(41H)-one |
| Molecular Formula | C15H24N2O |
| Purity | ≥95% |
| Target | Apoptosis Inducers |
| Solubility | DMSO：49 mg/mL，H2O：11 mg/mL （warmed) |
| Storage | 3 years -20C powder |
| IC50 | 540 μg/ml (inhibit gastric cancer cell line MNK45, MTT) |
| IUPAC Name | (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| InChI | InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-/m0/s1 |
| InChIKey | ZSBXGIUJOOQZMP-JLNYLFASSA-N |
| SMILES | C1C[C@@H]2[C@H]3CCCN4[C@H]3[C@@H](CCC4)CN2C(=O)C1 |
| Reference | <p style=/line-height:25px/> |
