For research use only. Not for therapeutic Use.
MBP146-78 (Cat.No:I013665) is a synthetic compound that has shown promise as a potential anti-inflammatory agent. It has been studied for its ability to inhibit the production of pro-inflammatory cytokines and reduce inflammation in various experimental models. MBP146-78 holds potential for the development of novel therapeutic interventions targeting inflammatory diseases. Further research is ongoing to explore its mechanism of action and therapeutic applications.
| Catalog Number | I013665 |
| CAS Number | 188343-77-3 |
| Molecular Formula | C₂₁H₂₂FN₃ |
| Purity | ≥95% |
| Target | Parasite |
| Solubility | 10 mM in DMSO |
| IUPAC Name | 4-[2-(4-fluorophenyl)-5-(1-methylpiperidin-4-yl)-1H-pyrrol-3-yl]pyridine |
| InChI | InChI=1S/C21H22FN3/c1-25-12-8-16(9-13-25)20-14-19(15-6-10-23-11-7-15)21(24-20)17-2-4-18(22)5-3-17/h2-7,10-11,14,16,24H,8-9,12-13H2,1H3 |
| InChIKey | RBWNFHXBUDPAIO-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C2=CC(=C(N2)C3=CC=C(C=C3)F)C4=CC=NC=C4 |
| Reference | [1]. Nare B, et al. Evaluation of a cyclic GMP-dependent protein kinase inhibitor in treatment of murine toxoplasmosis: gamma interferon is required for efficacy. Antimicrob Agents Chemother. 2002 Feb;46(2):300-7. |
