For research use only. Not for therapeutic Use.
MBQ-167（Cat No.:I019753）is a selective and potent inhibitor of the p110β isoform of phosphoinositide 3-kinase (PI3K), a key enzyme involved in cellular signaling pathways that regulate growth, proliferation, and survival. It is primarily researched for its potential applications in cancer therapy, as aberrant PI3K signaling is often implicated in tumorigenesis and cancer progression. By inhibiting p110β, MBQ-167 can effectively disrupt cancer cell proliferation and promote apoptosis. Its specificity for p110β over other PI3K isoforms may reduce off-target effects, making it a promising candidate for targeted cancer treatments and research applications in oncology.
| Catalog Number | I019753 |
| CAS Number | 2097938-73-1 |
| Molecular Formula | C₂₂H₁₈N₄ |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 9-ethyl-3-(5-phenyltriazol-1-yl)carbazole |
| InChI | InChI=1S/C22H18N4/c1-2-25-20-11-7-6-10-18(20)19-14-17(12-13-21(19)25)26-22(15-23-24-26)16-8-4-3-5-9-16/h3-15H,2H2,1H3 |
| InChIKey | LJCANTASZGYJLG-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)N3C(=CN=N3)C4=CC=CC=C4)C5=CC=CC=C51 |
| Reference | [1]. Humphries-Bickley T, et al. Characterization of a Dual Rac/Cdc42 Inhibitor MBQ-167 in Metastatic Cancer. Mol Cancer Ther. 2017 May;16(5):805-818. |
