For research use only. Not for therapeutic Use.
MBX-4132(Cat No.:I020018)is an innovative antibiotic under investigation for its potential to combat multidrug-resistant bacterial infections, particularly those caused by Gram-negative pathogens. It operates through a novel mechanism distinct from traditional antibiotics, which allows it to evade common resistance pathways. MBX-4132 shows efficacy in targeting bacterial ribosomes, thereby inhibiting protein synthesis and ultimately leading to bacterial cell death. With promising preclinical results, MBX-4132 holds potential in addressing the critical need for new treatments against resistant infections, particularly for hospital-acquired infections and difficult-to-treat bacterial strains.
Catalog Number | I020018 |
CAS Number | 2286411-30-9 |
Molecular Formula | C₁₈H₁₅FN₄O₂ |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
InChI | InChI=1S/C18H15FN4O2/c19-15-7-5-13(6-8-15)16-21-22-17(25-16)20-18(24)23-10-9-12-3-1-2-4-14(12)11-23/h1-8H,9-11H2,(H,20,22,24) |
InChIKey | OZHWSOOZCIJFQN-UHFFFAOYSA-N |
SMILES | C1CN(CC2=CC=CC=C21)C(=O)NC3=NN=C(O3)C4=CC=C(C=C4)F |
Reference | [1]. Anette Breindl, et al. Ribosome allows for multiple shots on giant goal. |