For research use only. Not for therapeutic Use.
MC-1568(Cat No.:I005119)is a selective inhibitor of the histone deacetylase 3 (HDAC3), a member of the histone deacetylase family involved in regulating gene expression, chromatin structure, and cellular processes such as differentiation and proliferation. By inhibiting HDAC3, MC-1568 promotes acetylation of histones and non-histone proteins, thereby altering gene expression patterns. It has demonstrated potential therapeutic effects in cancer, as HDAC3 is often upregulated in various tumors. MC-1568’s ability to selectively target HDAC3 without affecting other HDAC isoforms makes it a promising candidate for precision cancer therapy and other related diseases.
CAS Number | 852475-26-4 |
Synonyms | (E)-3-[4-[(E)-3-(3-fluorophenyl)-3-oxoprop-1-enyl]-1-methylpyrrol-2-yl]-N-hydroxyprop-2-enamide |
Molecular Formula | C₁₇H₁₅FN₂O₃ |
Purity | ≥95% |
Target | Epigenetics |
Solubility | DMSO: ≤ 18.5 mg/mL |
Storage | 3 years -20C powder |
IC50 | 100 nM (HD1-A, Maize); 3400 nM (HD1-B, Maize) |
IUPAC Name | (E)-3-[4-[(E)-3-(3-fluorophenyl)-3-oxoprop-1-enyl]-1-methylpyrrol-2-yl]-N-hydroxyprop-2-enamide |
InChI | InChI=1S/C17H15FN2O3/c1-20-11-12(9-15(20)6-8-17(22)19-23)5-7-16(21)13-3-2-4-14(18)10-13/h2-11,23H,1H3,(H,19,22)/b7-5+,8-6+ |
InChIKey | QRDAPCMJAOQZSU-KQQUZDAGSA-N |
SMILES | CN1C=C(C=C1/C=C/C(=O)NO)/C=C/C(=O)C2=CC(=CC=C2)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |