For research use only. Not for therapeutic Use.
MC-PEG2-NH2（Cat No.:I042297）is a chemical compound that consists of a methoxycoumarin (MC) group conjugated with a polyethylene glycol (PEG) chain of two repeating units, terminated with an amine group (NH2). This structure makes it useful in drug delivery and bioconjugation applications. The PEG2 chain enhances the solubility, stability, and bioavailability of the compound, while the methoxycoumarin group may be used for fluorescence tracking or imaging purposes. The amine group at the end of the PEG chain allows for further modification or attachment to other molecules, facilitating its use in various biomedical applications.
| Catalog Number | I042297 |
| CAS Number | 640267-62-5 |
| Synonyms | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| Molecular Formula | C16H27N3O5 |
| Purity | ≥95% |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| InChI | InChI=1S/C16H27N3O5/c17-7-10-23-12-13-24-11-8-18-14(20)4-2-1-3-9-19-15(21)5-6-16(19)22/h5-6H,1-4,7-13,17H2,(H,18,20) |
| InChIKey | BRPNMDKROWMZAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCCCC(=O)NCCOCCOCCN |
