For research use only. Not for therapeutic Use.
MC3482 is a specific sirtuin5 (SIRT5) inhibitor.
MC3482 inhibits sirtuin5. 50 μM MC3482 inhibits SIRT5 desuccinylating activity without affecting SIRT5 intracellular expression levels. Autophagy and mitophagy increase in SIRT5-silenced cells and in WT cells treated with MC3482 and decrease in SIRT5-overexpressing cells[1].
| Catalog Number | I046280 |
| CAS Number | 2922280-86-0 |
| Synonyms | (2S)-5-[[(5S)-6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| Molecular Formula | C33H38N4O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C33H38N4O8/c38-29(20-19-28(31(40)41)37-33(43)45-23-25-14-6-2-7-15-25)34-21-11-10-18-27(30(39)35-26-16-8-3-9-17-26)36-32(42)44-22-24-12-4-1-5-13-24/h1-9,12-17,27-28H,10-11,18-23H2,(H,34,38)(H,35,39)(H,36,42)(H,37,43)(H,40,41)/t27-,28-/m0/s1 |
| InChIKey | LDCYHYVNYRUUOL-NSOVKSMOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CCCCNC(=O)CCC(C(=O)O)NC(=O)OCC2=CC=CC=C2)C(=O)NC3=CC=CC=C3 |
| Reference | [1]. Polletta L, et al. SIRT5 regulation of ammonia-induced autophagy and mitophagy. Autophagy. 2015;11(2):253-70. |
