For research use only. Not for therapeutic Use.
MC70（Cat No.:I007921）is a potent and selective inhibitor of the enzyme methionine aminopeptidase-2 (MetAP2), which plays a critical role in protein synthesis and angiogenesis. By inhibiting MetAP2, MC70 disrupts the formation of blood vessels, effectively suppressing tumor growth and metastasis. Its anti-angiogenic properties make it a promising candidate in cancer therapy, particularly for tumors that are reliant on vascularization for growth. MC70 has also shown potential in targeting certain inflammatory diseases, offering a dual benefit in both oncology and inflammation-related conditions. Research into MC70’s therapeutic applications continues to expand.
| CAS Number | 1031367-64-2 |
| Synonyms | 4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenol |
| Molecular Formula | C24H25NO3 |
| Purity | ≥95% |
| IUPAC Name | 4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenol |
| InChI | InChI=1S/C24H25NO3/c1-27-23-13-20-11-12-25(16-21(20)14-24(23)28-2)15-17-3-5-18(6-4-17)19-7-9-22(26)10-8-19/h3-10,13-14,26H,11-12,15-16H2,1-2H3 |
| InChIKey | ATYXTVKHMLAWBZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CN(CCC2=C1)CC3=CC=C(C=C3)C4=CC=C(C=C4)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
