For research use only. Not for therapeutic Use.
MCB-613 (Cat No.: I000588) is a small molecule compound being studied for its potential therapeutic applications in cancer treatment. It functions as an inhibitor of specific molecular targets involved in cancer cell survival and proliferation, particularly in tumor microenvironments. By blocking these pathways, MCB-613 may disrupt cancer cell growth and metastasis. Preclinical research suggests that MCB-613 may enhance the effectiveness of other cancer therapies, making it a promising candidate for combination treatments. Clinical studies are underway to assess its safety, efficacy, and potential in oncology.
CAS Number | 1162656-22-5 |
Synonyms | (3E,5E)-1-ethyl-3,5-bis(pyridin-3-ylmethylene)piperidin-4-one |
Molecular Formula | C19H19N3O |
Purity | ≥95% |
Target | NF-κB |
Solubility | DMSO: ≤ 10 mg/mL |
Storage | Store at -20°C |
InChI | InChI=1S/C19H19N3O/c1-2-22-13-17(9-15-5-3-7-20-11-15)19(23)18(14-22)10-16-6-4-8-21-12-16/h3-12H,2,13-14H2,1H3/b17-9+,18-10+ |
InChIKey | LPGYWNGKCLRDNO-BEQMOXJMSA-N |
SMILES | O=C(/C(CN(CC)C/1)=C/C2=CC=CN=C2)C1=CC3=CN=CC=C3 |
Reference | <p style=/line-height:25px/> |