For research use only. Not for therapeutic Use.
Mcl1-IN-2(Cat No.:I003015), is a compound developed as an inhibitor of Mcl-1, a protein crucial for cancer cell survival. By selectively targeting Mcl-1, it aims to induce apoptosis and overcome drug resistance in cancer cells. Mcl1-IN-2 shows potential as a therapeutic agent in treating various cancers.
Catalog Number | I003015 |
CAS Number | 292057-76-2 |
Molecular Formula | C19H15N3OS |
Purity | ≥95% |
Target | Anti-infection |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | 7-[(pyridin-2-ylamino)-thiophen-2-ylmethyl]quinolin-8-ol |
InChI | InChI=1S/C19H15N3OS/c23-19-14(9-8-13-5-3-11-21-17(13)19)18(15-6-4-12-24-15)22-16-7-1-2-10-20-16/h1-12,18,23H,(H,20,22) |
InChIKey | ICJKSTJCIAGPIS-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)NC(C2=C(C3=C(C=CC=N3)C=C2)O)C4=CC=CS4 |
Reference | <p style=/line-height:25px/> |