For research use only. Not for therapeutic Use.
Mcl1-IN-3(Cat No.:I020097)is an experimental small molecule inhibitor targeting Mcl-1, an anti-apoptotic protein involved in regulating cell survival. Mcl-1 plays a crucial role in preventing programmed cell death (apoptosis), and its overexpression is often linked to cancer cell resistance to chemotherapy. By inhibiting Mcl-1, Mcl1-IN-3 aims to promote apoptosis in cancer cells, making them more susceptible to treatment. This compound is being investigated for its potential use in cancer therapies, particularly in cancers where Mcl-1 is overexpressed, such as certain leukemias and lymphomas. Its safety and efficacy are still under clinical evaluation.
CAS Number | 1814891-79-6 |
Molecular Formula | C₂₇H₂₂ClN₃O₄ |
Purity | ≥95% |
Target | Bcl-2 Family |
IUPAC Name | 1-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-6-(furan-2-yl)-3-methylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
InChI | InChI=1S/C27H22ClN3O4/c1-15-11-20(12-16(2)25(15)28)35-19-8-6-18(7-9-19)14-31-26-24(17(3)30-31)21(27(32)33)13-22(29-26)23-5-4-10-34-23/h4-13H,14H2,1-3H3,(H,32,33) |
InChIKey | LTAWGVCXLNOXJX-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1Cl)C)OC2=CC=C(C=C2)CN3C4=C(C(=N3)C)C(=CC(=N4)C5=CC=CO5)C(=O)O |