For research use only. Not for therapeutic Use.
McMMAF(CAT: I005185) is a potent antibody-drug conjugate (ADC) linker used in the development of targeted cancer therapies. It consists of a monomethyl auristatin F (MMAF) payload conjugated to an antibody through a maleimidocaproyl (Mc) linker. McMMAF is designed to selectively deliver the cytotoxic MMAF payload to cancer cells expressing the target antigen recognized by the antibody component of the ADC. Once internalized, the MMAF payload disrupts microtubule dynamics, leading to cell cycle arrest and apoptosis. McMMAF demonstrates promising anticancer activity and has shown efficacy in preclinical and clinical studies as a targeted therapy for various malignancies.
| Catalog Number | I005185 |
| CAS Number | 863971-19-1 |
| Molecular Formula | C49H76N6O11 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | (2S)-2-[[(2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanoyl]amino]-3-phenylpropanoic acid |
| InChI | InChI=1S/C49H76N6O11/c1-12-32(6)44(37(65-10)29-41(59)54-27-19-22-36(54)45(66-11)33(7)46(60)50-35(49(63)64)28-34-20-15-13-16-21-34)53(9)48(62)42(30(2)3)51-47(61)43(31(4)5)52(8)38(56)23-17-14-18-26-55-39(57)24-25-40(55)58/h13,15-16,20-21,24-25,30-33,35-37,42-45H,12,14,17-19,22-23,26-29H2,1-11H3,(H,50,60)(H,51,61)(H,63,64)/t32-,33+,35-,36-,37+,42-,43-,44-,45+/m0/s1 |
| InChIKey | ORFNVPGICPYLJV-YTVPMEHESA-N |
| SMILES | [C@H]([C@H](C(N[C@@H](CC1=CC=CC=C1)C(O)=O)=O)C)(OC)[C@]2(N(C(C[C@H]([C@@H](N(C([C@@H](NC([C@@H](N(C(CCCCCN3C(=O)C=CC3=O)=O)C)[C@@H](C)C)=O)C(C)C)=O)C)[C@H](CC)C)OC)=O)CCC2)[H] |
| Reference | <p style=”/line-height:25px/”> |
