For research use only. Not for therapeutic Use.
MCOPPB triHydrochloride(Cat No.:I000436)is a small-molecule inhibitor primarily known for its selective action on protein-protein interactions, particularly those involving the c-Myc oncoprotein. c-Myc plays a crucial role in cell cycle progression, apoptosis, and cellular transformation, making it a critical target in cancer therapy. By inhibiting c-Myc function, MCOPPB triHydrochloride has demonstrated potential in preclinical models to suppress tumor growth and induce apoptosis in cancer cells. This compound is being investigated for its therapeutic applications, particularly in cancers where c-Myc is overexpressed, and it may enhance the efficacy of existing cancer treatments.
CAS Number | 1108147-88-1 |
Synonyms | 1-[1-(1-methylcyclooctyl)piperidin-4-yl]-2-[(3R)-piperidin-3-yl]benzimidazole;trihydrochloride |
Molecular Formula | C26H40N4 • 3HCl |
Purity | ≥95% |
Target | NOP Receptor |
Solubility | DMSO: ≤ 13 mg/mL |
Storage | Store at -20C |
IC50 | 10.07 (pKi) |
IUPAC Name | 1-[1-(1-methylcyclooctyl)piperidin-4-yl]-2-[(3R)-piperidin-3-yl]benzimidazole;trihydrochloride |
InChI | InChI=1S/C26H40N4.3ClH/c1-26(15-7-3-2-4-8-16-26)29-18-13-22(14-19-29)30-24-12-6-5-11-23(24)28-25(30)21-10-9-17-27-20-21;;;/h5-6,11-12,21-22,27H,2-4,7-10,13-20H2,1H3;3*1H/t21-;;;/m1.../s1 |
InChIKey | DTIPEVOPCGEULQ-RFCADEKQSA-N |
SMILES | CC1(CCCCCCC1)N2CCC(CC2)N3C4=CC=CC=C4N=C3[C@@H]5CCCNC5.Cl.Cl.Cl |