For research use only. Not for therapeutic Use.
MCP110（Cat No.:I012489）is a selective small molecule inhibitor that targets the protein complex mTORC1 (mechanistic target of rapamycin complex 1), a key regulator of cell growth, metabolism, and protein synthesis. By inhibiting mTORC1, MCP110 can disrupt pathways involved in cancer cell proliferation and survival, making it a potential therapeutic candidate for cancer treatment. Additionally, mTORC1 inhibition has applications in managing metabolic disorders and aging-related diseases. MCP110 is under investigation in preclinical studies for its ability to suppress tumor growth and improve the efficacy of other anticancer therapies.
| Catalog Number | I012489 |
| CAS Number | 521310-51-0 |
| Synonyms | N-[(3-Methoxy-4-phenylmethoxyphenyl)methyl]-5-phenyl-N-(2-pyridin-2-ylethyl)pentanamide |
| Molecular Formula | C33H36N2O3 |
| Purity | ≥95% |
| Target | MAPK/ERK Pathway |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-5-phenyl-N-(2-pyridin-2-ylethyl)pentanamide |
| InChI | InChI=1S/C33H36N2O3/c1-37-32-24-29(19-20-31(32)38-26-28-15-6-3-7-16-28)25-35(23-21-30-17-10-11-22-34-30)33(36)18-9-8-14-27-12-4-2-5-13-27/h2-7,10-13,15-17,19-20,22,24H,8-9,14,18,21,23,25-26H2,1H3 |
| InChIKey | JWLZIHLAMJDONF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CN(CCC2=CC=CC=N2)C(=O)CCCCC3=CC=CC=C3)OCC4=CC=CC=C4 |
