For research use only. Not for therapeutic Use.
MDAI (5,6-Methylenedioxy-2-aminoindane)(CAT: R067509) is a synthetic psychoactive compound from the aminoindane class, developed as a non-neurotoxic alternative to MDMA (ecstasy). MDAI primarily acts as a serotonin-releasing agent, elevating mood and promoting feelings of empathy without significantly affecting dopamine levels, which may reduce its addictive potential. Although initially researched for its effects on serotonin and mood, MDAI has appeared in the recreational drug market. Its lower risk of neurotoxicity compared to MDMA makes it of interest in pharmacological studies. However, due to potential abuse and safety concerns, MDAI is regulated in many countries and is primarily used in research settings.
| Catalog Number | R067509 |
| CAS Number | 155344-90-4 |
| Synonyms | 5,6-Methylenedioxy-2-aminoindane |
| Molecular Formula | C10H12ClNO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6,7-dihydro-5H-cyclopenta[f][1,3]benzodioxol-6-amine;hydrochloride |
| InChI | InChI=1S/C10H11NO2.ClH/c11-8-1-6-3-9-10(13-5-12-9)4-7(6)2-8;/h3-4,8H,1-2,5,11H2;1H |
| InChIKey | DEZYWEZDXRXACY-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC3=C(C=C21)OCO3)N.Cl |
