For research use only. Not for therapeutic Use.
MDK24720(CAT: I007927) is a small molecule that has been identified as an inhibitor of the BET (bromodomain and extra-terminal domain) family of proteins. These proteins play a critical role in gene transcription and have been shown to be involved in the pathogenesis of various diseases, including cancer and inflammation. By inhibiting BET proteins, MDK24720 can potentially modulate gene expression and affect disease progression. MDK24720 has been shown to have anticancer activity in preclinical studies, and further research is ongoing to explore its therapeutic potential.
| Catalog Number | I007927 |
| CAS Number | 635324-72-0 |
| Synonyms | MDK24720; MDK 24720; MDK-24720; CTLA-4 inhibitor.;2-(4-Fluoro-phenyl)-6-methyl-4-(3-trifluoromethyl-phenyl)-1,6-dihydro-2H-1,2,5,6,7-pentaaza-as-indacen-3-one |
| Molecular Formula | C21H13F4N5O |
| Purity | ≥95% |
| Target | CD28 |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2-(4-fluorophenyl)-6-methyl-4-[3-(trifluoromethyl)phenyl]-1H-dipyrazolo[4,3-b:4/',5/'-e]pyridin-3-one |
| InChI | InChI=1S/C21H13F4N5O/c1-29-19-15(10-26-29)18-16(20(31)30(28-18)14-7-5-13(22)6-8-14)17(27-19)11-3-2-4-12(9-11)21(23,24)25/h2-10,28H,1H3 |
| InChIKey | WQKVVTLTCHDAST-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(N=C3C(C=NN3C)=C2NN1C4=CC=C(F)C=C4)C=5C=CC=C(C5)C(F)(F)F |
