For research use only. Not for therapeutic Use.
MDL 72222(CAT: I010257) is a selective antagonist of the 5-HT3 receptor, which is a subtype of serotonin (5-hydroxytryptamine) receptors. It acts by blocking the binding of serotonin to the 5-HT3 receptor, thereby inhibiting its function. The 5-HT3 receptor is primarily found in the central and peripheral nervous systems, and its activation is involved in various physiological and pathological processes, including nausea and vomiting. By blocking the 5-HT3 receptor, MDL 72222 can effectively reduce the symptoms associated with excessive serotonin activity, particularly in the context of nausea and vomiting.
| Catalog Number | I010257 |
| CAS Number | 40796-97-2 |
| Synonyms | Tropanyl 3,5-dichlorobenzoate |
| Molecular Formula | C15H17Cl2NO2 |
| Purity | ≥95% |
| Target | 5-HT Receptor |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at RT |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3,5-dichlorobenzoate |
| InChI | InChI=1S/C15H17Cl2NO2/c1-18-12-2-3-13(18)8-14(7-12)20-15(19)9-4-10(16)6-11(17)5-9/h4-6,12-14H,2-3,7-8H2,1H3/t12-,13+,14? |
| InChIKey | MNJNPLVXBISNSX-PBWFPOADSA-N |
| SMILES | CN1C2CCC1CC(C2)OC(=O)C3=CC(=CC(=C3)Cl)Cl |
