For research use only. Not for therapeutic Use.
mDPR(Boc)-Val-Cit-PAB(Cat No.:I017605)is a synthetic peptide construct used in drug delivery and cancer therapy. It consists of a combination of amino acids and a linker, including a protective Boc group (tert-butoxycarbonyl), a valine-citrulline dipeptide, and para-aminobenzoic acid (PAB). The structure is often used in the development of antibody-drug conjugates (ADCs) or prodrugs, where it helps improve the stability, targeting, and release of cytotoxic drugs specifically to cancer cells. The inclusion of a citrulline linker allows for selective cleavage by specific enzymes in the tumor environment, enhancing therapeutic efficacy while reducing systemic toxicity.
CAS Number | 2281797-55-3 |
Molecular Formula | C₃₀H₄₃N₇O₉ |
Purity | ≥95% |
Target | ADC Linker |
IUPAC Name | tert-butyl N-[(2S)-3-[[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-(2,5-dioxopyrrol-1-yl)-3-oxopropyl]carbamate |
InChI | InChI=1S/C30H43N7O9/c1-17(2)24(36-26(42)21(37-22(39)12-13-23(37)40)15-33-29(45)46-30(3,4)5)27(43)35-20(7-6-14-32-28(31)44)25(41)34-19-10-8-18(16-38)9-11-19/h8-13,17,20-21,24,38H,6-7,14-16H2,1-5H3,(H,33,45)(H,34,41)(H,35,43)(H,36,42)(H3,31,32,44)/t20-,21-,24-/m0/s1 |
InChIKey | MFRDXMXKXVDYPI-HFMPRLQTSA-N |
SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)NC(=O)[C@H](CNC(=O)OC(C)(C)C)N2C(=O)C=CC2=O |
Reference | [1]. LYON, Robert, et al. SELF-STABILIZING LINKER CONJUGATES. WO2013173337. |