For research use only. Not for therapeutic Use.
ME-1111(Cat No.:I007938)is a small-molecule compound under investigation for its potential therapeutic applications in cancer treatment. It is a selective inhibitor of the protein methyltransferase PRMT5 (protein arginine methyltransferase 5), which plays a crucial role in regulating gene expression, RNA splicing, and cell survival. Overexpression of PRMT5 has been linked to various cancers, including lymphomas and solid tumors. By inhibiting PRMT5, ME-1111 disrupts these critical cellular processes, leading to impaired tumor cell growth and increased apoptosis. ME-1111 is currently being evaluated in preclinical and clinical trials for its efficacy in oncology.
CAS Number | 1391758-52-3 |
Synonyms | ME-1111; ME 1111; ME1111.;2-(3,5-dimethyl-1H-pyrazol-1-yl)-5-methylphenol |
Molecular Formula | C12H14N2O |
Purity | ≥95% |
Target | Fungal |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-5-methylphenol |
InChI | InChI=1S/C12H14N2O/c1-8-4-5-11(12(15)6-8)14-10(3)7-9(2)13-14/h4-7,15H,1-3H3 |
InChIKey | VQXHPRBERPTLQW-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)N2C(=CC(=N2)C)C)O |