For research use only. Not for therapeutic Use.
Mebeverine acid-d5 hydrochloride（Cat No.:S000467） is a deuterated variant of mebeverine, a drug primarily used as an antispasmodic to treat irritable bowel syndrome (IBS) and related conditions. This specific form has five hydrogen atoms replaced with deuterium, which is aimed at enhancing the drug’s metabolic stability and facilitating detailed pharmacokinetic studies. As a hydrochloride salt, it improves the solubility and stability of the drug, making it more suitable for research purposes. Mebeverine works by relaxing the smooth muscle in the gut, reducing spasms and discomfort associated with IBS.
| Catalog Number | S000467 |
| CAS Number | 2070015-30-2 |
| Molecular Formula | C16H21D5ClNO3 |
| Purity | ≥95% |
| Target | Drug Metabolite |
| IUPAC Name | 4-[1-(4-methoxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butanoic acid;hydrochloride |
| InChI | InChI=1S/C16H25NO3.ClH/c1-4-17(11-5-6-16(18)19)13(2)12-14-7-9-15(20-3)10-8-14;/h7-10,13H,4-6,11-12H2,1-3H3,(H,18,19);1H/i1D3,4D2; |
| InChIKey | BOOAOGZTKZVSNS-UHBAQTEVSA-N |
| SMILES | CCN(CCCC(=O)O)C(C)CC1=CC=C(C=C1)OC.Cl |
