For research use only. Not for therapeutic Use.
Mebeverine Alcohol(CAT: I001688), a key metabolite of Mebeverine, is primarily used in gastrointestinal research. This compound is instrumental in studying smooth muscle relaxation mechanisms in disorders like irritable bowel syndrome (IBS). Mebeverine Alcohol aids in exploring its pharmacokinetics, metabolic pathways, and therapeutic potential. By understanding its role in modulating calcium channels and reducing intestinal spasms, researchers can uncover valuable insights into gastrointestinal health and treatment optimization. Its high purity and stability make it a reliable choice for advancing research in gastrointestinal pharmacology.
| Catalog Number | I001688 |
| CAS Number | 14367-47-6 |
| Molecular Formula | C16H27NO2 |
| Purity | ≥95% |
| Target | Drug Metabolite |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butan-1-ol |
| InChI | InChI=1S/C16H27NO2/c1-4-17(11-5-6-12-18)14(2)13-15-7-9-16(19-3)10-8-15/h7-10,14,18H,4-6,11-13H2,1-3H3 |
| InChIKey | ZGZAPRVKIAFOPL-UHFFFAOYSA-N |
| SMILES | CCN(CCCCO)C(C)CC1=CC=C(C=C1)OC |
