For research use only. Not for therapeutic Use.
Mebhydrolin is a specific histamine H1 receptor antagonist.
Mebhydrolin is a specific histamine H1-receptor antagonist and comparing it with the effects of chlorpromazine, the archetypical phenothiazine[1]. Mebhydrolin exerts an antihistaminic effect over the period of the ethanol interaction study[2].
| Catalog Number | I020246 |
| CAS Number | 524-81-2 |
| Synonyms | 5-benzyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| Molecular Formula | C19H20N2 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H20N2/c1-20-12-11-19-17(14-20)16-9-5-6-10-18(16)21(19)13-15-7-3-2-4-8-15/h2-10H,11-14H2,1H3 |
| InChIKey | FQQIIPAOSKSOJM-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C3=CC=CC=C3N2CC4=CC=CC=C4 |
| Reference | [1]. O’Neill PA, et al. Chlorpromazine-a specific effect on breathlessness? Br J Clin Pharmacol. 1985 Jun;19(6):793-7. [2]. Franks HM, et al. Interaction between ethanol and antihistamines: 3. Mebhydrolin. Med J Aust. 1981 Oct 31;2(9):477-9. |
