For research use only. Not for therapeutic Use.
Mebrofenin is a pharmaceutical compound used in nuclear medicine imaging procedures of the liver and gallbladder. It is primarily employed as a radiopharmaceutical agent in hepatobiliary scintigraphy, a diagnostic imaging technique. Mebrofenin is administered intravenously and accumulates in the liver, allowing for the visualization and evaluation of liver function, bile duct patency, and gallbladder morphology. Its selective uptake by hepatocytes and excretion into bile make it valuable for diagnosing various liver and biliary tract disorders.
| Catalog Number | R045330 |
| CAS Number | 78266-06-5 |
| Synonyms | Glycine, N-[2-[(3-bromo-2,4,6-trimethylphenyl)amino]-2-oxoethyl]-N-(carboxymethyl)-2: PN: US20040033243 PAGE: 23 Claimed Protein; Mebrofenin; SQ 26962 |
| Molecular Formula | C15H19BrN2O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[[2-(3-bromo-2,4,6-trimethylanilino)-2-oxoethyl]-(carboxymethyl)amino]acetic acid |
| InChI | InChI=1S/C15H19BrN2O5/c1-8-4-9(2)15(10(3)14(8)16)17-11(19)5-18(6-12(20)21)7-13(22)23/h4H,5-7H2,1-3H3,(H,17,19)(H,20,21)(H,22,23) |
| InChIKey | MHPZZZZLAQGTHT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1NC(=O)CN(CC(=O)O)CC(=O)O)C)Br)C |
