For research use only. Not for therapeutic Use.
Mecarbinate（Cat No.:A001035）is a high-purity cardiotonic agent widely used in pharmacological research for its effects on cardiac function. Known for its ability to enhance myocardial contractility, it is studied for potential applications in treating heart failure and other cardiac conditions. Mecarbinate modulates calcium handling and energy metabolism in cardiac cells, making it a valuable tool for exploring mechanisms underlying cardiotonic activity. Its stability and efficacy ensure reliable results in preclinical and experimental studies, supporting the development of novel therapeutic strategies in cardiovascular research.
| Catalog Number | A001035 |
| CAS Number | 15574-49-9 |
| Synonyms | Dimecarbin |
| Molecular Formula | C13H15NO3 |
| Purity | ≥95% |
| Target | HCV |
| Storage | 3 years -20C powder |
| IUPAC Name | ethyl 5-hydroxy-1,2-dimethylindole-3-carboxylate |
| InChI | InChI=1S/C13H15NO3/c1-4-17-13(16)12-8(2)14(3)11-6-5-9(15)7-10(11)12/h5-7,15H,4H2,1-3H3 |
| InChIKey | YTBNTDMBGXAOCG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=C1C=C(C=C2)O)C)C |
