For research use only. Not for therapeutic Use.
Mecoprop-d3 is a deuterated form of the herbicide mecoprop, used for studying the behavior and environmental fate of the non-deuterated analog. It functions as a selective systemic herbicide targeting broadleaf weeds by mimicking plant hormones (auxins), leading to uncontrolled growth and eventual plant death. The deuterium atoms enhance its stability, making it useful in environmental and agricultural chemistry for tracing and analyzing herbicide residues and degradation pathways. Mecoprop-d3 is crucial for research in developing safer and more effective herbicidal formulations and understanding environmental impact.
CAS Number | 352431-15-3 |
Synonyms | 2-(4-Chloro-2-methylphenoxy-d3)propionic Acid; (+/-)-Mecoprop-d3; (+/-)-2-(4-Chloro-2-methylphenoxy)propanoic Acid-d3; 2-(p-Chloro-o-tolyloxy)propionic Acid-d3; 2M4KhP-d3; Anicon B-d3; Celatox CMPP-d3; Compitox-d3; Isocarnox-d3; MCPP-d3; Mechlorprop- |
Molecular Formula | C10H11ClO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)propanoic acid |
InChI | InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/i3D,4D,5D |
InChIKey | WNTGYJSOUMFZEP-QGZYMEECSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1OC(C)C(=O)O)C)[2H])Cl)[2H] |