For research use only. Not for therapeutic Use.
Medicarpin is a naturally occurring pterocarpan, a type of isoflavonoid, found in various legumes, including species in the Fabaceae family. It is known for its phytoestrogenic, antifungal, and anti-inflammatory properties. Medicarpin has been studied for its potential benefits in bone health, as it promotes osteoblast activity, which is crucial for bone formation and repair. Additionally, it has shown promise in protecting against bone loss in conditions like osteoporosis. Beyond its role in bone health, medicarpin also exhibits antimicrobial activity, particularly against fungal pathogens, making it of interest in both agricultural and medical research.
| Catalog Number | R006670 |
| CAS Number | 32383-76-9 |
| Molecular Formula | C16H14O4 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | (6aR,11aR)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
| InChI | InChI=1S/C16H14O4/c1-18-10-3-5-11-13-8-19-14-6-9(17)2-4-12(14)16(13)20-15(11)7-10/h2-7,13,16-17H,8H2,1H3/t13-,16-/m0/s1 |
| InChIKey | NSRJSISNDPOJOP-BBRMVZONSA-N |
| SMILES | COC1=CC2=C(C=C1)C3COC4=C(C3O2)C=CC(=C4)O |
