For research use only. Not for therapeutic Use.
Medioresinol(Cat No.:R013280)is a plant-derived lignan with notable antioxidant and potential health-promoting properties. Found in various seeds, fruits, and grains, it serves as a precursor to enterolignans, which are bioactive compounds linked to cardiovascular and hormonal health. In the body, medioresinol is converted into enterolactone and enterodiol, contributing to its potential protective effects against certain chronic diseases. Studies suggest that medioresinol may support heart health and reduce oxidative stress, making it a valuable compound in nutraceutical research and dietary applications targeting overall wellness.
CAS Number | 40957-99-1 |
Molecular Formula | C21H24O7 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | 4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol |
InChI | InChI=1S/C21H24O7/c1-24-16-6-11(4-5-15(16)22)20-13-9-28-21(14(13)10-27-20)12-7-17(25-2)19(23)18(8-12)26-3/h4-8,13-14,20-23H,9-10H2,1-3H3/t13-,14-,20+,21+/m0/s1 |
InChIKey | VJOBNGRIBLNUKN-BMHXQBNDSA-N |
SMILES | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |