For research use only. Not for therapeutic Use.
Mefenoxam(Cat No.:R069494)is a systemic fungicide used in agriculture for the control of various soil-borne and seed-borne fungal pathogens. It inhibits fungal RNA polymerase, thereby disrupting the production of essential fungal proteins and preventing fungal growth. Mefenoxam is particularly effective against pathogens like Pythium spp. and Phytophthora spp., which cause significant crop diseases. It is widely used in seed treatment, soil drenching, and foliar applications. Mefenoxam is known for its high efficacy, rapid action, and ability to offer residual protection, ensuring better crop yield and quality.
CAS Number | 70630-17-0 |
Synonyms | Metalaxyl-M, R-Metalaxyl, Methyl N-(methoxyacetyl)-N-(2,6-xylyl)-D-alaninate |
Molecular Formula | C15H21NO4 |
Purity | ≥95% |
Target | Fungal |
Storage | RT |
IUPAC Name | methyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate |
InChI | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m1/s1 |
InChIKey | ZQEIXNIJLIKNTD-GFCCVEGCSA-N |
SMILES | CC1=C(C(=CC=C1)C)N([C@H](C)C(=O)OC)C(=O)COC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |