For research use only. Not for therapeutic Use.
Mefexamide hydrochloride (Cat No.: I031871) is a central nervous system (CNS) stimulant belonging to the amphetamine class, once explored for its psychostimulant and antidepressant effects. It was investigated for enhancing alertness, mood, and mental performance by increasing levels of neurotransmitters like dopamine and norepinephrine. However, due to concerns over efficacy, side effects, and potential for abuse, it was never widely adopted or marketed. Mefexamide hydrochloride is now primarily of historical or research interest in the context of early stimulant drug development.
| CAS Number | 3413-64-7 |
| Synonyms | N-[2-(diethylamino)ethyl]-2-(4-methoxyphenoxy)acetamide;hydrochloride |
| Molecular Formula | C15H25ClN2O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H24N2O3.ClH/c1-4-17(5-2)11-10-16-15(18)12-20-14-8-6-13(19-3)7-9-14;/h6-9H,4-5,10-12H2,1-3H3,(H,16,18);1H |
| InChIKey | AXBHPHPHZHAOAK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)COC1=CC=C(C=C1)OC.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
