For research use only. Not for therapeutic Use.
MEK-IN-6（Cat No.:I041156）is a selective small molecule inhibitor that targets MEK (Mitogen-Activated Protein Kinase Kinase), a critical enzyme in the MAPK/ERK signaling pathway. This pathway regulates essential cellular processes such as growth, differentiation, and survival. By inhibiting MEK, MEK-IN-6 blocks downstream signaling that is often upregulated in various cancers, making it a promising therapeutic candidate for treating tumors with dysregulated MAPK/ERK activity. MEK-IN-6 is being explored in preclinical studies for its potential to treat cancers such as melanoma, non-small cell lung cancer, and other malignancies driven by MEK activation.
| CAS Number | 2845151-86-0 |
| Synonyms | 8-(2-fluoro-4-methylsulfanylanilino)-2-(2-hydroxyethoxy)-7-methyl-3,4-dihydro-2,7-naphthyridine-1,6-dione |
| Molecular Formula | C18H20FN3O4S |
| Purity | ≥95% |
| IUPAC Name | 8-(2-fluoro-4-methylsulfanylanilino)-2-(2-hydroxyethoxy)-7-methyl-3,4-dihydro-2,7-naphthyridine-1,6-dione |
| InChI | InChI=1S/C18H20FN3O4S/c1-21-15(24)9-11-5-6-22(26-8-7-23)18(25)16(11)17(21)20-14-4-3-12(27-2)10-13(14)19/h3-4,9-10,20,23H,5-8H2,1-2H3 |
| InChIKey | TURWFFGYNJNSFK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C2CCN(C(=O)C2=C1NC3=C(C=C(C=C3)SC)F)OCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
