For research use only. Not for therapeutic Use.
MEK inhibitor is a potent MEK inhibitor with antitumor potency.
MEK inhibitor is a potent MEK inhibitor. MEK is a kinase enzyme which phosphorylates MAPKs. The activated MAPK leads to the phosphorylation of downstream transcription factors that regulate various responses such as stress signaling, pathogen response, and hormone signaling.
CAS Number | 334951-92-7 |
Synonyms | 3-[N-[3-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-N-methyl-1H-indole-6-carboxamide |
Molecular Formula | C26H26N4O2 |
Purity | ≥95% |
InChI | InChI=1S/C26H26N4O2/c1-27-25(31)19-12-13-21-22(15-19)29-26(32)23(21)24(18-9-5-4-6-10-18)28-20-11-7-8-17(14-20)16-30(2)3/h4-15,29,32H,16H2,1-3H3,(H,27,31) |
InChIKey | UPICVLXBXZXYIE-UHFFFAOYSA-N |
SMILES | CNC(=O)C1=CC2=C(C=C1)C(=C(N2)O)C(=NC3=CC=CC(=C3)CN(C)C)C4=CC=CC=C4 |